Compound Q&A

What is 3-Amino(peg4)propionic acid 3-maleimidopropionamide (CAS: 1263045-16-4)?

Answer

3-Amino(peg4)propionic acid 3-maleimidopropionamide
3-Amino(peg4)propionic acid 3-maleimidopropionamide is a chemical compound with the CAS number 1263045-16-4. It is a maleimide derivative that combines amino acid functionality with polyethylene glycol chains. This compound is characterized by its ability to form covalent bonds, making it useful for various applications in bioconjugation and drug delivery systems.

About

English Name 3-Amino(peg4)propionic acid 3-maleimidopropionamide
Molecular Formula C18H28N2O9
Molecular Weight 416.43 g/mol
SMILES O=C(CCN1C(=O)C=CC1=O)NCCOCCOCCOCCOCCC(=O)O C18H28N2O9
InChIKey IAJVEYLYYHOZEY-UHFFFAOYSA-N
Last Updated: 2025-10-21 21:33

Related Q&A

Compound Q&A

What are the main uses of 3-Amino(peg4)propionic acid 3-maleimidopropionamide (CAS: 1263045-16-4)?

This compound is primarily used in pharmaceuticals and biotechnology for bioconjugation reactions, d...

Compound Q&A

Is 3-Amino(peg4)propionic acid 3-maleimidopropionamide (CAS: 1263045-16-4) safe?

3-Amino(peg4)propionic acid 3-maleimidopropionamide is generally considered safe for laboratory use ...

Compound Q&A

How should 3-Amino(peg4)propionic acid 3-maleimidopropionamide (CAS: 1263045-16-4) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and moisture. It is re...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...