Compound Q&A

What are the main uses of 2'-O-(2-Methoxyethyl)cytidine (CAS: 223777-16-0)?

Answer

2'-O-(2-Methoxyethyl)cytidine
2'-O-(2-Methoxyethyl)cytidine is primarily used in pharmaceutical research for developing antiviral drugs. It is also explored for its potential therapeutic effects in treating viral infections such as hepatitis C and influenza. Additionally, it serves as a valuable reagent in chemical synthesis and biological studies.

About

English Name 2'-O-(2-Methoxyethyl)cytidine
Molecular Formula C12H19N3O6
Molecular Weight 301.3 g/mol
SMILES OC[C@@H]1[C@H]([C@H]([C@H](N2C(N=C(C=C2)N)=O)O1)OCCOC)O
InChIKey YKOGMMXZKKVMBT-QCNRFFRDSA-N
Last Updated: 2025-10-21 21:33

Related Q&A

Compound Q&A

What is 2'-O-(2-Methoxyethyl)cytidine (CAS: 223777-16-0)?

2'-O-(2-Methoxyethyl)cytidine is a nucleoside derivative with the chemical formula C12H17N3O5. It is...

Compound Q&A

Is 2'-O-(2-Methoxyethyl)cytidine (CAS: 223777-16-0) safe?

2'-O-(2-Methoxyethyl)cytidine is generally considered safe when handled with appropriate precautions...

Compound Q&A

How should 2'-O-(2-Methoxyethyl)cytidine (CAS: 223777-16-0) be stored?

2'-O-(2-Methoxyethyl)cytidine should be stored in a cool, dry place with a temperature range of 15-2...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...