Compound Q&A

What are the main uses of 2,5-Dibromonicotinic acid (CAS: 29312-99-0)?

Answer

2,5-Dibromonicotinic acid
2,5-Dibromonicotinic acid is primarily used as a precursor in the synthesis of other compounds, particularly in the pharmaceutical industry. It is also used in research and as an analytical reagent due to its unique chemical properties.

About

CAS No 29312-99-0
English Name 2,5-Dibromonicotinic acid
Molecular Formula C6H3Br2NO2
Molecular Weight 280.9 g/mol
SMILES C1=C(C=NC(=C1C(=O)O)Br)Br
InChIKey BRPWRSWAXHWEPS-UHFFFAOYSA-N
Last Updated: 2025-10-21 21:33

Related Q&A

Compound Q&A

What is 2,5-Dibromonicotinic acid (CAS: 29312-99-0)?

2,5-Dibromonicotinic acid is a derivative of nicotinic acid (vitamin B3) with two bromine atoms atta...

Compound Q&A

Is 2,5-Dibromonicotinic acid (CAS: 29312-99-0) safe?

2,5-Dibromonicotinic acid is generally safe when handled with proper precautions. However, it is cor...

Compound Q&A

How should 2,5-Dibromonicotinic acid (CAS: 29312-99-0) be stored?

2,5-Dibromonicotinic acid should be stored in a tightly sealed container in a cool, dry place away f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...