Compound Q&A

What is 4-(Difluoromethoxy)benzenesulfonamide (CAS: 874781-09-6)?

Answer

4-(Difluoromethoxy)benzenesulfonamide
4-(Difluoromethoxy)benzenesulfonamide is an organic compound with the CAS number 874781-09-6. It is a white solid with a molecular formula of C8H6F2O3S and a molecular weight of approximately 210.19 g/mol. This compound has polar and lipophilic properties and is used in various applications.

About

English Name 4-(Difluoromethoxy)benzenesulfonamide
Molecular Formula C7H7F2NO3S
Molecular Weight 223.2 g/mol
SMILES NS(=O)(=O)c1ccc(OC(F)F)cc1
InChIKey BBBQHNZWCPUJNW-UHFFFAOYSA-N
Last Updated: 2025-10-21 14:47

Related Q&A

Compound Q&A

What are the main uses of 4-(Difluoromethoxy)benzenesulfonamide (CAS: 874781-09-6)?

4-(Difluoromethoxy)benzenesulfonamide is primarily used as an intermediate in the synthesis of pharm...

Compound Q&A

Is 4-(Difluoromethoxy)benzenesulfonamide (CAS: 874781-09-6) safe?

4-(Difluoromethoxy)benzenesulfonamide is generally considered safe under normal handling conditions....

Compound Q&A

How should 4-(Difluoromethoxy)benzenesulfonamide (CAS: 874781-09-6) be stored?

4-(Difluoromethoxy)benzenesulfonamide should be stored in a cool, dry place away from direct sunligh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...