Compound Q&A

How should 4-Benzyl-2-morpholinecarboxylic acid (CAS: 769087-80-1) be stored?

Answer

4-Benzyl-2-morpholinecarboxylic acid
4-Benzyl-2-morpholinecarboxylic acid should be stored in a cool, dry place to prevent degradation. It should be kept away from heat, open flames, and direct sunlight. Use a tightly sealed container to store the compound, and avoid exposure to moisture and humidity.

About

English Name 4-Benzyl-2-morpholinecarboxylic acid
Molecular Formula C12H15NO3
Molecular Weight 221.26 g/mol
SMILES C1COC(CN1CC2=CC=CC=C2)C(=O)O
InChIKey UJDWIUOGWSDEFP-UHFFFAOYSA-N
Last Updated: 2025-10-21 14:47

Related Q&A

Compound Q&A

What is 4-Benzyl-2-morpholinecarboxylic acid (CAS: 769087-80-1)?

4-Benzyl-2-morpholinecarboxylic acid is a chemical compound with the CAS number 769087-80-1. It is a...

Compound Q&A

What are the main uses of 4-Benzyl-2-morpholinecarboxylic acid (CAS: 769087-80-1)?

4-Benzyl-2-morpholinecarboxylic acid is primarily used in the pharmaceutical industry as a precursor...

Compound Q&A

Is 4-Benzyl-2-morpholinecarboxylic acid (CAS: 769087-80-1) safe?

4-Benzyl-2-morpholinecarboxylic acid is generally considered safe when handled properly. However, it...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...