Compound Q&A

What is 3-(Methoxycarbonyl)-2-nitrobenzoic acid (CAS: 861593-27-3)?

Answer

3-(Methoxycarbonyl)-2-nitrobenzoic acid
3-(Methoxycarbonyl)-2-nitrobenzoic acid (CAS: 861593-27-3) is an organic compound with the molecular formula C8H7NO5. It is a white to off-white crystalline solid with a pungent odor. This compound is used in various industries including pharmaceuticals, where it serves as an intermediate in the synthesis of other organic compounds.

About

English Name 3-(Methoxycarbonyl)-2-nitrobenzoic acid
Molecular Formula C9H7NO6
Molecular Weight 225.16 g/mol
SMILES COC(=O)c1cccc(c1[N+](=O)[O-])C(=O)O
InChIKey NUULGBPUCNUUQD-UHFFFAOYSA-N
Last Updated: 2025-10-21 14:47

Related Q&A

Compound Q&A

What are the main uses of 3-(Methoxycarbonyl)-2-nitrobenzoic acid (CAS: 861593-27-3)?

3-(Methoxycarbonyl)-2-nitrobenzoic acid (CAS: 861593-27-3) is primarily used as an intermediate in t...

Compound Q&A

Is 3-(Methoxycarbonyl)-2-nitrobenzoic acid (CAS: 861593-27-3) safe?

3-(Methoxycarbonyl)-2-nitrobenzoic acid (CAS: 861593-27-3) is generally safe when handled with prope...

Compound Q&A

How should 3-(Methoxycarbonyl)-2-nitrobenzoic acid (CAS: 861593-27-3) be stored?

3-(Methoxycarbonyl)-2-nitrobenzoic acid (CAS: 861593-27-3) should be stored in tightly sealed contai...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...