Compound Q&A

How should 3-Amino-3-(4-methoxyphenyl)propanoic acid (CAS: 5678-45-5) be stored?

Answer

3-Amino-3-(4-methoxyphenyl)propanoic acid
3-Amino-3-(4-methoxyphenyl)propanoic acid (CAS: 5678-45-5) should be stored in a cool, dry place away from direct sunlight and heat sources to maintain its stability. It is recommended to store the compound in a tightly closed container to prevent moisture absorption and degradation. Proper labeling is advised to ensure its safe handling.

About

CAS No 5678-45-5
English Name 3-Amino-3-(4-methoxyphenyl)propanoic acid
Molecular Formula C10H13NO3
Molecular Weight 195.22 g/mol
SMILES COC1=CC=C(C=C1)C(CC(=O)O)N
InChIKey NYTANCDDCQVQHG-UHFFFAOYSA-N
Last Updated: 2025-10-21 14:47

Related Q&A

Compound Q&A

What is 3-Amino-3-(4-methoxyphenyl)propanoic acid (CAS: 5678-45-5)?

3-Amino-3-(4-methoxyphenyl)propanoic acid (CAS: 5678-45-5) is an aromatic amino acid derivative with...

Compound Q&A

What are the main uses of 3-Amino-3-(4-methoxyphenyl)propanoic acid (CAS: 5678-45-5)?

3-Amino-3-(4-methoxyphenyl)propanoic acid (CAS: 5678-45-5) is primarily used as a precursor in the s...

Compound Q&A

Is 3-Amino-3-(4-methoxyphenyl)propanoic acid (CAS: 5678-45-5) safe?

3-Amino-3-(4-methoxyphenyl)propanoic acid (CAS: 5678-45-5) is generally considered safe for laborato...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...