Compound Q&A

Is 3-Bromo-4-fluorobenzene-1-sulfonyl chloride (CAS: 631912-19-1) safe?

Answer

3-Bromo-4-fluorobenzene-1-sulfonyl chloride
3-Bromo-4-fluorobenzene-1-sulfonyl chloride (CAS: 631912-19-1) is generally safe when handled with proper precautions. However, it is corrosive and can irritate the skin and eyes. Users should wear protective equipment such as gloves and goggles, and ensure adequate ventilation. Avoid contact with water, as it can cause a violent reaction.

About

English Name 3-Bromo-4-fluorobenzene-1-sulfonyl chloride
Molecular Formula C6H3BrClFO2S
Molecular Weight 273.51 g/mol
SMILES C1=CC(=C(C=C1S(=O)(=O)Cl)Br)F
InChIKey BEEHKBVVTWJSRH-UHFFFAOYSA-N
Last Updated: 2025-10-21 14:47

Related Q&A

Compound Q&A

What is 3-Bromo-4-fluorobenzene-1-sulfonyl chloride (CAS: 631912-19-1)?

3-Bromo-4-fluorobenzene-1-sulfonyl chloride (CAS: 631912-19-1) is an organic compound with a molecul...

Compound Q&A

What are the main uses of 3-Bromo-4-fluorobenzene-1-sulfonyl chloride (CAS: 631912-19-1)?

3-Bromo-4-fluorobenzene-1-sulfonyl chloride (CAS: 631912-19-1) is primarily used in the synthesis of...

Compound Q&A

How should 3-Bromo-4-fluorobenzene-1-sulfonyl chloride (CAS: 631912-19-1) be stored?

3-Bromo-4-fluorobenzene-1-sulfonyl chloride (CAS: 631912-19-1) should be stored in a cool, dry place...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...