Compound Q&A

How should Diethyl 2-[(dimethoxyphosphoryl)sulfanyl]succinate (CAS: 1634-78-2) be stored?

Answer

Diethyl 2-[(dimethoxyphosphoryl)sulfanyl]succinate
Diethyl 2-[(dimethoxyphosphoryl)sulfanyl]succinate (CAS: 1634-78-2) should be stored in a cool, dry place away from direct sunlight and heat sources. It is recommended to keep the compound in a tightly sealed container to prevent degradation. Avoid exposure to moisture and maintain a temperature between 15°C and 25°C for optimal stability.

About

CAS No 1634-78-2
English Name Diethyl 2-[(dimethoxyphosphoryl)sulfanyl]succinate
Molecular Formula C10H19O7PS
Molecular Weight 314.3 g/mol
SMILES CCOC(=O)CC(C(=O)OCC)SP(=O)(OC)OC
InChIKey WSORODGWGUUOBO-UHFFFAOYSA-N
Last Updated: 2025-10-21 14:47

Related Q&A

Compound Q&A

What is Diethyl 2-[(dimethoxyphosphoryl)sulfanyl]succinate (CAS: 1634-78-2)?

Diethyl 2-[(dimethoxyphosphoryl)sulfanyl]succinate (CAS: 1634-78-2) is a chemical compound with a co...

Compound Q&A

What are the main uses of Diethyl 2-[(dimethoxyphosphoryl)sulfanyl]succinate (CAS: 1634-78-2)?

Diethyl 2-[(dimethoxyphosphoryl)sulfanyl]succinate (CAS: 1634-78-2) is primarily used in the pharmac...

Compound Q&A

Is Diethyl 2-[(dimethoxyphosphoryl)sulfanyl]succinate (CAS: 1634-78-2) safe?

Diethyl 2-[(dimethoxyphosphoryl)sulfanyl]succinate (CAS: 1634-78-2) is generally safe when handled w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...