Compound Q&A

What are the main uses of (2R)-Hydroxy(4-methoxyphenyl)acetic acid (CAS: 20714-89-0)?

Answer

(2R)-Hydroxy(4-methoxyphenyl)acetic acid
(2R)-Hydroxy(4-methoxyphenyl)acetic acid is primarily used as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. It also serves as a building block for the production of other organic compounds. Additionally, it is used in research for studying the properties of similar compounds and in certain industrial applications for its chemical reactivity.

About

CAS No 20714-89-0
English Name (2R)-Hydroxy(4-methoxyphenyl)acetic acid
Molecular Formula C9H10O4
Molecular Weight 182.17 g/mol
SMILES COC1=CC=C(C=C1)C(C(=O)O)O
InChIKey ITECRQOOEQWFPE-MRVPVSSYSA-N
Last Updated: 2025-10-21 14:47

Related Q&A

Compound Q&A

What is (2R)-Hydroxy(4-methoxyphenyl)acetic acid (CAS: 20714-89-0)?

(2R)-Hydroxy(4-methoxyphenyl)acetic acid, also known as 2-(4-methoxyphenyl)actic acid, is a chemical...

Compound Q&A

Is (2R)-Hydroxy(4-methoxyphenyl)acetic acid (CAS: 20714-89-0) safe?

The safety of (2R)-Hydroxy(4-methoxyphenyl)acetic acid depends on the application and exposure level...

Compound Q&A

How should (2R)-Hydroxy(4-methoxyphenyl)acetic acid (CAS: 20714-89-0) be stored?

To ensure the stability and safety of (2R)-Hydroxy(4-methoxyphenyl)acetic acid, it should be stored ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...