Compound Q&A

What are the main uses of Methyl 2,4,5-trifluorobenzoate (CAS: 20372-66-1)?

Answer

Methyl 2,4,5-trifluorobenzoate
Methyl 2,4,5-trifluorobenzoate (CAS: 20372-66-1) is primarily used in the pharmaceutical and chemical industries. It serves as a key intermediate in the synthesis of other compounds, particularly in the development of drugs. Additionally, it is used in the production of certain dyes, plasticizers, and other chemical products.

About

CAS No 20372-66-1
English Name Methyl 2,4,5-trifluorobenzoate
Molecular Formula C8H5F3O2
Molecular Weight 190.12 g/mol
SMILES O=C(OC)C1=CC(F)=C(F)C=C1F
InChIKey WHJMGBFVYCLTFS-UHFFFAOYSA-N
Last Updated: 2025-10-21 14:47

Related Q&A

Compound Q&A

What is Methyl 2,4,5-trifluorobenzoate (CAS: 20372-66-1)?

Methyl 2,4,5-trifluorobenzoate (CAS: 20372-66-1) is an organic compound with the molecular formula C...

Compound Q&A

Is Methyl 2,4,5-trifluorobenzoate (CAS: 20372-66-1) safe?

Methyl 2,4,5-trifluorobenzoate (CAS: 20372-66-1) is generally considered safe under normal handling ...

Compound Q&A

How should Methyl 2,4,5-trifluorobenzoate (CAS: 20372-66-1) be stored?

Methyl 2,4,5-trifluorobenzoate (CAS: 20372-66-1) should be stored in a cool, dry place away from dir...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...