Compound Q&A

Are there alternatives to 2-Chloro-5-quinolinecarboxylic acid (CAS: 1092287-30-3) in synthesis?

Answer

2-Chloro-5-quinolinecarboxylic acid
Alternative reagents for synthesis of compounds similar to 2-Chloro-5-quinolinecarboxylic acid (CAS: 1092287-30-3) include 2-Quinolinecarboxylic acid and various chlorination products of quinoline. These alternatives can be used based on the specific requirements of the reaction and the desired product properties. Common synthetic routes involve chlorination of 2-Quinolinecarboxylic acid or other quinoline derivatives using chlorine gas or other chlorinating agents.

About

English Name 2-Chloro-5-quinolinecarboxylic acid
Molecular Formula C10H6ClNO2
Molecular Weight 207.62 g/mol
SMILES c1cc(c2ccc(nc2c1)Cl)C(=O)O
InChIKey PIDMGSRYEKDYOU-UHFFFAOYSA-N
Last Updated: 2025-10-21 00:33

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2-Chloro-5-quinolinecarboxylic acid (CAS: 1092287-30-3)?

2-Chloro-5-quinolinecarboxylic acid (CAS: 1092287-30-3) is classified under the Globally Harmonized ...

Compound Q&A

What is the market or research trend for 2-Chloro-5-quinolinecarboxylic acid (CAS: 1092287-30-3)?

The market for 2-Chloro-5-quinolinecarboxylic acid (CAS: 1092287-30-3) is primarily driven by its ap...

Compound Q&A

How should waste containing 2-Chloro-5-quinolinecarboxylic acid (CAS: 1092287-30-3) be handled?

Waste containing 2-Chloro-5-quinolinecarboxylic acid (CAS: 1092287-30-3) should be collected in appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...