Compound Q&A

Are there alternatives to 2-(Carboxymethyl)-4-nitrobenzoic acid (CAS: 39585-32-5) in synthesis?

Answer

2-(Carboxymethyl)-4-nitrobenzoic acid
Several alternatives to 2-(Carboxymethyl)-4-nitrobenzoic acid can be used in synthesis, depending on the specific application. For example, 4-nitrobenzoic acid and 2-carboxybenzoic acid are common substitutes. Additionally, other derivatives of benzoic acid, such as 3-nitrobenzoic acid or 5-nitrobenzoic acid, can be used as alternatives. The choice of alternative depends on the desired properties and the reaction conditions.

About

CAS No 39585-32-5
English Name 2-(Carboxymethyl)-4-nitrobenzoic acid
Molecular Formula C9H7NO6
Molecular Weight 225.16 g/mol
SMILES O=C(O)C1=CC=C([N+]([O-])=O)C=C1CC(O)=O
InChIKey CKXXWBQEZGLFMV-UHFFFAOYSA-N
Last Updated: 2025-10-21 00:33

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2-(Carboxymethyl)-4-nitrobenzoic acid (CAS: 39585-32-5)?

2-(Carboxymethyl)-4-nitrobenzoic acid (CAS: 39585-32-5) is subject to various regulatory guidelines....

Compound Q&A

What is the market or research trend for 2-(Carboxymethyl)-4-nitrobenzoic acid (CAS: 39585-32-5)?

The market for 2-(Carboxymethyl)-4-nitrobenzoic acid (CAS: 39585-32-5) shows steady growth, driven b...

Compound Q&A

How should waste containing 2-(Carboxymethyl)-4-nitrobenzoic acid (CAS: 39585-32-5) be handled?

Waste containing 2-(Carboxymethyl)-4-nitrobenzoic acid (CAS: 39585-32-5) should be handled with care...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...