Compound Q&A

Are there alternatives to Echinocandin B (CAS: 79411-15-7) in synthesis?

Answer

Echinocandin B, 1-[(4R,5R)-4,5-dihydroxy-L-ornithine]-
Alternative reagents to Echinocandin B (CAS: 79411-15-7) are available in synthesis, including other echinocandins and related compounds. For instance, some synthetic routes employ L-ornithine or its analogs. These alternatives offer varying degrees of efficacy and can be chosen based on the specific requirements of the synthesis, such as yield, reaction conditions, and cost.

About

CAS No 79411-15-7
English Name Echinocandin B, 1-[(4R,5R)-4,5-dihydroxy-L-ornithine]-
Molecular Formula C34H51N7O15
Molecular Weight 797.8 g/mol
SMILES CC1CN2C(C1O)C(=O)NC(C(CC(C(=O)NC(C(=O)N3CC(CC3C(=O)NC(C(=O)NC(C2=O)C(C)O)C(C(C4=CC=C(C=C4)O)O)O)O)C(C)O)N)O)O
InChIKey BLKJKIJFNJAQIZ-UHFFFAOYSA-N
Last Updated: 2025-10-21 00:33

Related Q&A

Compound Q&A

What regulatory guidelines apply to Echinocandin B (CAS: 79411-15-7)?

Echinocandin B (CAS: 79411-15-7) is subject to several regulatory guidelines. Globally, it falls und...

Compound Q&A

What is the market or research trend for Echinocandin B (CAS: 79411-15-7)?

The market for Echinocandin B (CAS: 79411-15-7) is driven by ongoing research in antifungal drug dev...

Compound Q&A

How should waste containing Echinocandin B (CAS: 79411-15-7) be handled?

Waste containing Echinocandin B (CAS: 79411-15-7) should be managed according to regulatory guidelin...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...