Compound Q&A

Are there alternatives to (S)-tert-Butyl 3-aminoazepane-1-carboxylate in synthesis?

Answer

(S)-tert-Butyl 3-aminoazepane-1-carboxylate
There are several alternatives to (S)-tert-Butyl 3-aminoazepane-1-carboxylate in synthesis, including other aminoazepane derivatives, such as (R)-tert-Butyl 3-aminoazepane-1-carboxylate or other azepane-based compounds. These alternatives can provide similar functional groups for various applications, such as医药中间体, without the specific stereochemistry of (S)-tert-Butyl 3-aminoazepane-1-carboxylate. Common alternative reagents include various amino acids and amine derivatives.

About

English Name (S)-tert-Butyl 3-aminoazepane-1-carboxylate
Molecular Formula C11H22N2O2
Molecular Weight 214.31 g/mol
SMILES CC(C)(C)OC(=O)N1CCCCC(C1)N
InChIKey WXWILWLHHQGUCX-VIFPVBQESA-N
Last Updated: 2025-10-20 19:48

Related Q&A

Compound Q&A

What regulatory guidelines apply to (S)-tert-Butyl 3-aminoazepane-1-carboxylate (CAS: 625471-04-7)?

The compound (S)-tert-Butyl 3-aminoazepane-1-carboxylate (CAS: 625471-04-7) is subject to regulatory...

Compound Q&A

What is the market or research trend for (S)-tert-Butyl 3-aminoazepane-1-carboxylate?

The market for (S)-tert-Butyl 3-aminoazepane-1-carboxylate is growing due to its use in the synthesi...

Compound Q&A

How should waste containing (S)-tert-Butyl 3-aminoazepane-1-carboxylate be handled?

Waste containing (S)-tert-Butyl 3-aminoazepane-1-carboxylate (CAS: 625471-04-7) should be handled ac...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...