Compound Q&A

Are there alternatives to 5-Bromo-2-methoxybenzenesulfonyl chloride (CAS: 23095-05-8) in synthesis?

Answer

5-Bromo-2-methoxybenzenesulfonyl chloride
While 5-Bromo-2-methoxybenzenesulfonyl chloride (CAS: 23095-05-8) is widely used, there are alternatives such as 2-methoxybenzenesulfonyl chloride or other brominated compounds, which can be considered depending on the specific requirements. Common analogs and isomers include 4-bromo-2-methoxybenzenesulfonyl chloride, which may offer similar reactivity profiles.

About

CAS No 23095-05-8
English Name 5-Bromo-2-methoxybenzenesulfonyl chloride
Molecular Formula C7H6BrClO3S
Molecular Weight 285.55 g/mol
SMILES COC1=C(C=C(C=C1)Br)S(=O)(=O)Cl
InChIKey IXSBNNRUQYYMRM-UHFFFAOYSA-N
Last Updated: 2025-10-20 12:31

Related Q&A

Compound Q&A

What regulatory guidelines apply to 5-Bromo-2-methoxybenzenesulfonyl chloride (CAS: 23095-05-8)?

5-Bromo-2-methoxybenzenesulfonyl chloride (CAS: 23095-05-8) is subject to various regulatory guideli...

Compound Q&A

What is the market or research trend for 5-Bromo-2-methoxybenzenesulfonyl chloride (CAS: 23095-05-8)?

The market for 5-Bromo-2-methoxybenzenesulfonyl chloride (CAS: 23095-05-8) is driven by its use in p...

Compound Q&A

How should waste containing 5-Bromo-2-methoxybenzenesulfonyl chloride (CAS: 23095-05-8) be handled?

Waste containing 5-Bromo-2-methoxybenzenesulfonyl chloride (CAS: 23095-05-8) should be handled by co...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...