Compound Q&A

Are there alternatives to 2-Methyl-2-propanyl (2-bromo-1,3-thiazol-5-yl)carbamate (CAS: 1094070-77-5) in synthesis?

Answer

2-Methyl-2-propanyl (2-bromo-1,3-thiazol-5-yl)carbamate
Alternatives to this compound in synthesis may include other thiazole derivatives or related carbamates. Common substitutes could involve using 2-bromo-1,3-thiazol-5-yl isothiocyanate or 2-bromo-1,3-thiazol-5-yl methyl isocyanate, depending on the specific application and desired chemical properties.

About

English Name 2-Methyl-2-propanyl (2-bromo-1,3-thiazol-5-yl)carbamate
Molecular Formula C8H11BrN2O2S
Molecular Weight 279.16 g/mol
SMILES CC(C)(C)OC(=O)NC1=CN=C(S1)Br
InChIKey DXTQRJCFSNCPMD-UHFFFAOYSA-N
Last Updated: 2025-10-20 12:31

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl (2-bromo-1,3-thiazol-5-yl)carbamate (CAS: 1094070-77-5)?

This compound is subject to various regulatory guidelines including the Globally Harmonized System o...

Compound Q&A

What is the market or research trend for 2-Methyl-2-proanyl (2-bromo-1,3-thiazol-5-yl)carbamate (CAS: 1094070-77-5)?

Market trends for this compound indicate increasing research interest due to its potential applicati...

Compound Q&A

How should waste containing 2-Methyl-2-proanyl (2-bromo-1,3-thiazol-5-yl)carbamate (CAS: 1094070-77-5) be handled?

Waste containing this compound should be collected in lined containers and stored in a well-ventilat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...