Compound Q&A

What industries use 1,2-Dichloro-3,3,4,4,5,5-Hexafluorocyclopentene (CAS: 706-79-6)?

Answer

1,2-Dichloro-3,3,4,4,5,5-hexafluorocyclopentene
1,2-Dichloro-3,3,4,4,5,5-Hexafluorocyclopentene is used in various industries, including pharmaceuticals for the synthesis of certain intermediates, polymers as a monomer, and in the production of sensors due to its unique chemical properties. It also plays a role in semiconductor manufacturing as a precursor material.

About

CAS No 706-79-6
English Name 1,2-Dichloro-3,3,4,4,5,5-hexafluorocyclopentene
Molecular Formula C5Cl2F6
Molecular Weight 244.95 g/mol
SMILES C1(=C(C(C(C1(F)F)(F)F)(F)F)Cl)Cl
InChIKey ABPBVCKGWWGZDP-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2-Dichloro-3,3,4,4,5,5-Hexafluorocyclopentene (CAS: 706-79-6)?

1,2-Dichloro-3,3,4,4,5,5-Hexafluorocyclopentene (CAS: 706-79-6) is a colorless liquid with a molecul...

Compound Q&A

How is 1,2-Dichloro-3,3,4,4,5,5-Hexafluorocyclopentene (CAS: 706-79-6) typically synthesized?

1,2-Dichloro-3,3,4,4,5,5-Hexafluorocyclopentene is typically synthesized via the chlorination of 1,3...

Compound Q&A

What precautions should be taken when handling 1,2-Dichloro-3,3,4,4,5,5-Hexafluorocyclopentene (CAS: 706-79-6)?

When handling 1,2-Dichloro-3,3,4,4,5,5-Hexafluorocyclopentene (CAS: 706-79-6), appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...