Compound Q&A

What industries use 7-Nitrobenzo[d]thiazol-2-amine (CAS: 89793-81-7)?

Answer

7-Nitrobenzo[d]thiazol-2-amine
7-Nitrobenzo[d]thiazol-2-amine is used in various industries, including pharmaceuticals for its potential as a precursor in drug synthesis, and in sensors for its ability to detect certain analytes. In the field of chemistry, it is also applied in the development of new materials, particularly in the synthesis of organic semiconductors and conducting polymers.

About

CAS No 89793-81-7
English Name 7-Nitrobenzo[d]thiazol-2-amine
Molecular Formula C7H5N3O2S
Molecular Weight 195.2 g/mol
SMILES C1=CC2=C(C(=C1)[N+](=O)[O-])SC(=N2)N
InChIKey JMRCAIHFSHXPPH-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Nitrobenzo[d]thiazol-2-amine (CAS: 89793-81-7)?

7-Nitrobenzo[d]thiazol-2-amine is a crystalline compound with a molecular weight of approximately 23...

Compound Q&A

How is 7-Nitrobenzo[d]thiazol-2-amine (CAS: 89793-81-7) typically synthesized?

7-Nitrobenzo[d]thiazol-2-amine is typically synthesized by nitration of benzo[d]thiazol-2-amine usin...

Compound Q&A

What precautions should be taken when handling 7-Nitrobenzo[d]thiazol-2-amine (CAS: 89793-81-7)?

When handling 7-Nitrobenzo[d]thiazol-2-amine, it is important to use personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...