Compound Q&A

What industries use (2R)-2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid (CAS: 70918-53-5)?

Answer

(2R)-2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid
(2R)-2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid finds applications in various industries. It is primarily used in the pharmaceutical sector as a precursor for drug synthesis and in the production of organic dyes. It also has potential use in the polymer industry for the development of functional polymers and in the sensor industry for its electrophilic character. Additionally, it can be utilized in the semiconductor industry for specialized chemical processes.

About

CAS No 70918-53-5
English Name (2R)-2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid
Molecular Formula C9H8O4
Molecular Weight 180.16 g/mol
SMILES C1C(OC2=CC=CC=C2O1)C(=O)O
InChIKey HMBHAQMOBKLWRX-MRVPVSSYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid (CAS: 70918-53-5)?

(2R)-2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid is a white or light yellow crystalline solid wit...

Compound Q&A

How is (2R)-2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid (CAS: 70918-53-5) typically synthesized?

(2R)-2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid can be synthesized via a multi-step process invo...

Compound Q&A

What precautions should be taken when handling (2R)-2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid (CAS: 70918-53-5)?

When handling (2R)-2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid, it is important to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...