Compound Q&A

What are the physical and chemical properties of 8-Methylnonyl nonanoate (CAS: 109-32-0)?

Answer

8-Methylnonyl nonanoate
8-Methylnonyl nonanoate (CAS: 109-32-0) is a colorless to light yellow liquid with a fruity odor. It has a molecular weight of approximately 246.37 g/mol and a density of about 0.898 g/cm³. The compound is soluble in common organic solvents such as ethanol and acetone but has limited solubility in water. It is relatively stable under normal conditions but can react with strong oxidizers and reducing agents. Its boiling point is around 276°C, and it has a flash point of 95°C.

About

CAS No 109-32-0
English Name 8-Methylnonyl nonanoate
Molecular Formula C19H38O2
Molecular Weight 298.51 g/mol
SMILES CCCCCCCCC(=O)OCCCCCCCC(C)C
InChIKey GBLPOPTXAXWWPO-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is 8-Methylnonyl nonanoate (CAS: 109-32-0) typically synthesized?

8-Methylnonyl nonanoate is typically synthesized through the esterification of nonanoic acid with 8-...

Compound Q&A

What industries use 8-Methylnonyl nonanoate (CAS: 109-32-0)?

8-Methylnonyl nonanoate (CAS: 109-32-0) is used in a variety of industries. It is commonly used as a...

Compound Q&A

What precautions should be taken when handling 8-Methylnonyl nonanoate (CAS: 109-32-0)?

When handling 8-Methylnonyl nonanoate (CAS: 109-32-0), it is important to follow standard safety gui...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...