Compound Q&A

What precautions should be taken when handling (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-oxo-5-(tritylamino)pentanoic acid (CAS: 283160-20-3)?

Answer

(3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-oxo-5-(tritylamino)pentanoic acid
When handling (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-oxo-5-(tritylamino)pentanoic acid (CAS: 283160-20-3), it is important to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be stored in a cool, dry place away from direct sunlight. In case of a spill, it should be cleaned up with appropriate absorbent materials. Always consult the Safety Data Sheet (SDS) for specific handling instructions and emergency procedures.

About

English Name (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-oxo-5-(tritylamino)pentanoic acid
Molecular Formula C39H34N2O5
Molecular Weight 610.71 g/mol
SMILES C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NC(=O)CC(CC(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46
InChIKey AOQYYASFUBPOHJ-PMERELPUSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-oxo-5-(tritylamino)pentanoic acid (CAS: 283160-20-3)?

The compound (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-oxo-5-(tritylamino)pentanoic acid (C...

Compound Q&A

How is (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-oxo-5-(tritylamino)pentanoic acid (CAS: 283160-20-3) typically synthesized?

The compound is typically synthesized through a multi-step process involving coupling of a trityl-pr...

Compound Q&A

What industries use (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-oxo-5-(tritylamino)pentanoic acid (CAS: 283160-20-3)?

This compound is commonly used in the pharmaceutical industry for the development of drug intermedia...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...