Compound Q&A

What are the physical and chemical properties of Diisopropyl sebacate (CAS: 7491-02-3)?

Answer

Diisopropyl sebacate
Diisopropyl sebacate (CAS: 7491-02-3) is a colorless, viscous liquid. It has a high molecular weight and a low melting point. It is slightly soluble in water but soluble in most organic solvents. Chemically, it is less reactive compared to other esters, showing good stability under normal conditions.

About

CAS No 7491-02-3
English Name Diisopropyl sebacate
Molecular Formula C16H30O4
Molecular Weight 286.41 g/mol
SMILES CC(C)OC(=O)CCCCCCCCC(=O)OC(C)C
InChIKey XFKBBSZEQRFVSL-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is Diisopropyl sebacate (CAS: 7491-02-3) typically synthesized?

Diisopropyl sebacate is typically synthesized through the esterification reaction between sebacic ac...

Compound Q&A

What industries use Diisopropyl sebacate (CAS: 7491-02-3)?

Diisopropyl sebacate (CAS: 7491-02-3) is widely used in the rubber and plastic industries for improv...

Compound Q&A

What precautions should be taken when handling Diisopropyl sebacate (CAS: 7491-02-3)?

When handling Diisopropyl sebacate (CAS: 7491-02-3), it is important to use proper personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...