Compound Q&A

What are the physical and chemical properties of Methyl 5-bromo-2-chlorobenzoate (CAS: 251085-87-7)?

Answer

Methyl 5-bromo-2-chlorobenzoate
Methyl 5-bromo-2-chlorobenzoate is a crystalline compound with a molecular weight of approximately 264.03 g/mol. It has a low solubility in water but is more soluble in organic solvents such as ethanol and acetone. Chemically, it is moderately reactive, particularly towards nucleophiles, and can undergo substitution reactions. It is typically used in synthetic organic chemistry.

About

English Name Methyl 5-bromo-2-chlorobenzoate
Molecular Formula C8H6BrClO2
Molecular Weight 249.49 g/mol
SMILES COC(=O)C1=C(C=CC(=C1)Br)Cl
InChIKey DOVGGQQIXPPXDC-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is methyl 5-bromo-2-chlorobenzoate (CAS: 251085-87-7) typically synthesized?

Methyl 5-bromo-2-chlorobenzoate is commonly synthesized through the bromination of 2-chlorobenzoic a...

Compound Q&A

What industries use methyl 5-bromo-2-chlorobenzoate (CAS: 251085-87-7)?

Methyl 5-bromo-2-chlorobenzoate is utilized in the pharmaceutical industry for the synthesis of cert...

Compound Q&A

What precautions should be taken when handling methyl 5-bromo-2-chlorobenzoate (CAS: 251085-87-7)?

When handling methyl 5-bromo-2-chlorobenzoate, it is important to use personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...