Compound Q&A

What industries use Magnesium bis(2-oxopropanoate) (CAS: 81686-75-1)?

Answer

Magnesium bis(2-oxopropanoate)
Magnesium bis(2-oxopropanoate) is used in various industries, including pharmaceuticals for drug synthesis, polymers for modifying properties, and sensors for detecting specific chemical species. It also finds applications in the production of semiconductors due to its stability and reactivity.

About

CAS No 81686-75-1
English Name Magnesium bis(2-oxopropanoate)
Molecular Formula C6H6MgO6
Molecular Weight 198.41 g/mol
SMILES CC(=O)C(=O)[O-].CC(=O)C(=O)[O-].[Mg+2]
InChIKey IGDSPVZZOMJIPB-UHFFFAOYSA-L
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Magnesium bis(2-oxopropanoate) (CAS: 81686-75-1)?

Magnesium bis(2-oxopropanoate) is a white crystalline solid with a molecular weight of approximately...

Compound Q&A

How is Magnesium bis(2-oxopropanoate) (CAS: 81686-75-1) typically synthesized?

Magnesium bis(2-oxopropanoate) is typically synthesized by reacting magnesium oxide or magnesium hyd...

Compound Q&A

What precautions should be taken when handling Magnesium bis(2-oxopropanoate) (CAS: 81686-75-1)?

When handling Magnesium bis(2-oxopropanoate), always wear appropriate personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...