Compound Q&A

What are the physical and chemical properties of 9H-Fluorene-9,9-diyldimethanol (CAS: 4425-93-8)?

Answer

9H-Fluorene-9,9-diyldimethanol
9H-Fluorene-9,9-diyldimethanol (CAS: 4425-93-8) is a clear, colorless liquid with a crystalline form at room temperature. It has a molecular weight of approximately 232.24 g/mol. The compound is moderately soluble in common organic solvents like ethanol and acetone but is essentially insoluble in water. It is known for its high reactivity in polymerization and other chemical reactions, making it useful in various applications.

About

CAS No 4425-93-8
English Name 9H-Fluorene-9,9-diyldimethanol
Molecular Formula C15H14O2
Molecular Weight 226.28 g/mol
SMILES OCC1(CO)C2=C(C3=C1C=CC=C3)C=CC=C2
InChIKey RHBLISBUFROBBC-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is 9H-Fluorene-9,9-diyldimethanol (CAS: 4425-93-8) typically synthesized?

9H-Fluorene-9,9-diyldimethanol (CAS: 4425-93-8) is typically synthesized via the hydration of 9,9-bi...

Compound Q&A

What industries use 9H-Fluorene-9,9-diyldimethanol (CAS: 4425-93-8)?

9H-Fluorene-9,9-diyldimethanol (CAS: 4425-93-8) is widely used in the polymer industry for the synth...

Compound Q&A

What precautions should be taken when handling 9H-Fluorene-9,9-diyldimethanol (CAS: 4425-93-8)?

When handling 9H-Fluorene-9,9-diyldimethanol (CAS: 4425-93-8), it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...