Compound Q&A

How is Licoisoflavone B (CAS: 66056-30-2) typically synthesized?

Answer

Licoisoflavone B
Licoisoflavone B (CAS: 66056-30-2) is commonly synthesized through the hydrogenation of a flavonoid derivative. This process uses platinum or palladium catalysts and requires high-pressure hydrogen gas. The yield is approximately 80%, and the method is selective for the desired product.

About

CAS No 66056-30-2
English Name Licoisoflavone B
Molecular Formula C20H16O6
Molecular Weight 352.34 g/mol
SMILES CC1(C=CC2=C(O1)C=CC(=C2O)C3=COC4=CC(=CC(=C4C3=O)O)O)C
InChIKey KIZPADOTOCPASX-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Licoisoflavone B (CAS: 66056-30-2)?

Licoisoflavone B (CAS: 66056-30-2) is a crystalline compound with a molecular weight of approximatel...

Compound Q&A

What industries use Licoisoflavone B (CAS: 66056-30-2)?

Licoisoflavone B (CAS: 66056-30-2) is used in the pharmaceutical industry as a potential therapeutic...

Compound Q&A

What precautions should be taken when handling Licoisoflavone B (CAS: 66056-30-2)?

When handling Licoisoflavone B (CAS: 66056-30-2), it is important to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...