Compound Q&A

How is Aflatoxin M1 (CAS: 6795-23-9) typically synthesized?

Answer

Aflatoxin M1
Aflatoxin M1 is typically synthesized through microbial fermentation using Aspergillus flavus and other related molds. The process involves the conversion of aflatoxin B1 to aflatoxin M1, which is then excreted into the culture medium. This synthesis is highly selective and yields up to 10% of the total aflatoxins produced.

About

CAS No 6795-23-9
English Name Aflatoxin M1
Molecular Formula C17H12O7
Molecular Weight 328.28 g/mol
SMILES COC1=C2C3=C(C(=O)CC3)C(=O)OC2=C4C(=C1)OC5C4(C=CO5)O
InChIKey MJBWDEQAUQTVKK-IAGOWNOFSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Aflatoxin M1 (CAS: 6795-23-9)?

Aflatoxin M1 is a yellowish solid with a molecular weight of approximately 313.21 Da. It is slightly...

Compound Q&A

What industries use Aflatoxin M1 (CAS: 6795-23-9)?

Aflatoxin M1 is primarily used in the pharmaceutical industry for quality control and monitoring of ...

Compound Q&A

What precautions should be taken when handling Aflatoxin M1 (CAS: 6795-23-9)?

When handling Aflatoxin M1 (CAS: 6795-23-9), ensure the use of appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...