Compound Q&A

How is Sodium aminoacetate 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione (1:1:1) (CAS: 8000-10-0) typically synthesized?

Answer

Sodium aminoacetate 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione (1:1:1)
Sodium aminoacetate 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione (1:1:1) (CAS: 8000-10-0) is typically synthesized through a condensation reaction between 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione and sodium aminoacetate. The reaction usually occurs in a solvent such as ethanol or methanol, and is catalyzed by a strong base like sodium hydroxide. The yield is around 70-80%, and the product can be isolated by recrystallization from water.

About

CAS No 8000-10-0
English Name Sodium aminoacetate 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione (1:1:1)
Molecular Formula C9H12N5NaO4
Molecular Weight 277.21 g/mol
SMILES CN1C2=C(C(=O)N(C1=O)C)NC=N2.C(C(=O)[O-])N.[Na+]
InChIKey AIJQWRAOMFRHTQ-UHFFFAOYSA-M
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sodium aminoacetate 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione (1:1:1) (CAS: 8000-10-0)?

Sodium aminoacetate 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione (1:1:1) (CAS: 8000-10-0) is a cryst...

Compound Q&A

What industries use Sodium aminoacetate 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione (1:1:1) (CAS: 8000-10-0)?

Sodium aminoacetate 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione (1:1:1) (CAS: 8000-10-0) is used in...

Compound Q&A

What precautions should be taken when handling Sodium aminoacetate 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione (1:1:1) (CAS: 8000-10-0)?

When handling Sodium aminoacetate 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione (1:1:1) (CAS: 8000-10...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...