Compound Q&A

What are the physical and chemical properties of N,N'-Dimethyl-1,1'-binaphthalene-2,2'-diamine (CAS: 666175-40-2)?

Answer

N,N'-Dimethyl-1,1'-binaphthalene-2,2'-diamine
N,N'-Dimethyl-1,1'-binaphthalene-2,2'-diamine is a crystalline compound with a molecular weight of approximately 306.3 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and dichloromethane. Chemically, it is stable but can react with strong acids. It has a high melting point and is known for its strong coordination ability.

About

English Name N,N'-Dimethyl-1,1'-binaphthalene-2,2'-diamine
Molecular Formula C22H20N2
Molecular Weight 312.416 g/mol
SMILES CNC1=CC=C2C=CC=CC2=[C@]1[C@]3=C4C=CC=CC4=CC=C3NC
InChIKey PXDKDUXMEHPNCO-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is N,N'-Dimethyl-1,1'-binaphthalene-2,2'-diamine (CAS: 666175-40-2) typically synthesized?

N,N'-Dimethyl-1,1'-binaphthalene-2,2'-diamine is usually synthesized through nucleophilic substituti...

Compound Q&A

What industries use N,N'-Dimethyl-1,1'-binaphthalene-2,2'-diamine (CAS: 666175-40-2)?

N,N'-Dimethyl-1,1'-binaphthalene-2,2'-diamine is used in various industries, including pharmaceutica...

Compound Q&A

What precautions should be taken when handling N,N'-Dimethyl-1,1'-binaphthalene-2,2'-diamine (CAS: 666175-40-2)?

When handling N,N'-Dimethyl-1,1'-binaphthalene-2,2'-diamine, it is essential to wear appropriate per...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...