Compound Q&A

What are the physical and chemical properties of 1-{15-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-15-oxo-3,6,9,12-tetraoxapentadec-1-yl}-1H-pyrrole-2,5-dione (CAS: 1325208-25-0)?

Answer

1-{15-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-15-oxo-3,6,9,12-tetraoxapentadec-1-yl}-1H-pyrrole-2,5-dione
This compound is a crystalline solid with a molecular weight of approximately 432.43 g/mol. It is moderately soluble in organic solvents like dichloromethane and acetone. Chemically, it is highly reactive due to its pyrrole and carboxylic acid functionalities. It readily undergoes nucleophilic substitution and can form hydrogen bonds due to its carboxylic acid group.

About

English Name 1-{15-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-15-oxo-3,6,9,12-tetraoxapentadec-1-yl}-1H-pyrrole-2,5-dione
Molecular Formula C19H26N2O10
Molecular Weight 442.42 g/mol
SMILES O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCN2C(C=CC2=O)=O
InChIKey TUPOSLKVPPFQGR-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is 1-{15-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-15-oxo-3,6,9,12-tetraoxapentadec-1-yl}-1H-pyrrole-2,5-dione (CAS: 1325208-25-0) typically synthesized?

This compound can be synthesized via a multistep process involving the condensation of a 15-carbon a...

Compound Q&A

What industries use 1-{15-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-15-oxo-3,6,9,12-tetraoxapentadec-1-yl}-1H-pyrrole-2,5-dione (CAS: 1325208-25-0)?

This compound is used in pharmaceuticals for its potential as a drug intermediate, in sensors due to...

Compound Q&A

What precautions should be taken when handling 1-{15-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-15-oxo-3,6,9,12-tetraoxapentadec-1-yl}-1H-pyrrole-2,5-dione (CAS: 1325208-25-0)?

When handling this compound, it is crucial to wear appropriate personal protective equipment (PPE) s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...