Compound Q&A

What industries use [3-Fluoro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 864759-68-2)?

Answer

[3-Fluoro-4-(trifluoromethyl)phenyl]boronic acid
[3-Fluoro-4-(trifluoromethyl)phenyl]boronic acid is used in various industries, particularly in pharmaceuticals and organic synthesis. It plays a crucial role in the development of new drugs and is also used in the synthesis of other organic compounds. Additionally, it finds applications in the preparation of boronic acid derivatives for use in sensors and semiconductors.

About

English Name [3-Fluoro-4-(trifluoromethyl)phenyl]boronic acid
Molecular Formula C7H5BF4O2
Molecular Weight 207.91899999999998 g/mol
SMILES B(c1ccc(c(c1)F)C(F)(F)F)(O)O
InChIKey OPDBJTGUPJBGII-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of [3-Fluoro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 864759-68-2)?

[3-Fluoro-4-(trifluoromethyl)phenyl]boronic acid is a solid with a crystalline form. Its molecular w...

Compound Q&A

How is [3-Fluoro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 864759-68-2) typically synthesized?

[3-Fluoro-4-(trifluoromethyl)phenyl]boronic acid is usually prepared via the Suzuki coupling reactio...

Compound Q&A

What precautions should be taken when handling [3-Fluoro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 864759-68-2)?

When handling [3-Fluoro-4-(trifluoromethyl)phenyl]boronic acid, it is essential to use appropriate p...

Compound Q&A

What is the market or research trend for N-Methylphenylalanine (CAS: 2566-30-5)?

The market for N-Methylphenylalanine (CAS: 2566-30-5) is growing due to its appl...

2566-30-5N-Methylphenylalanin...
Compound Q&A

What are the main uses of 4-[(1R)-1-Aminoethyl]benzonitrile (CAS: 210488-53-2)?

4-[(1R)-1-Aminoethyl]benzonitrile (CAS: 210488-53-2) is primarily used in pharma...

210488-53-24-[(1R)-1-Aminoethyl...
Compound Q&A

Is 2-Hydroxy-N-{3-[3-(1-piperidinylmethyl)phenoxy]propyl}acetamide ethanedioate (CAS: 110925-92-3) safe?

2-Hydroxy-N-{3-[3-(1-piperidinylmethyl)phenoxy]propyl}acetamide ethanedioate (CA...

110925-92-32-Hydroxy-N-{3-[3-(1...
Compound Q&A

What are the physical and chemical properties of 2-(5-Oxazolyl)benzoic Acid (CAS: 169508-94-5)?

2-(5-Oxazolyl)benzoic Acid (CAS: 169508-94-5) is a white crystalline solid with ...

169508-94-52-(5-Oxazolyl)benzoi...