Compound Q&A

How is [3-Fluoro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 864759-68-2) typically synthesized?

Answer

[3-Fluoro-4-(trifluoromethyl)phenyl]boronic acid
[3-Fluoro-4-(trifluoromethyl)phenyl]boronic acid is usually prepared via the Suzuki coupling reaction. The synthesis typically involves the reaction of 3-fluoro-4-(trifluoromethyl)phenyllithium with bis(pinacolato)diboron in the presence of a palladium catalyst, such as Pd(PPh3)4, and an additive like potassium acetate. The yield is generally high, and the reaction is selective and efficient.

About

English Name [3-Fluoro-4-(trifluoromethyl)phenyl]boronic acid
Molecular Formula C7H5BF4O2
Molecular Weight 207.91899999999998 g/mol
SMILES B(c1ccc(c(c1)F)C(F)(F)F)(O)O
InChIKey OPDBJTGUPJBGII-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of [3-Fluoro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 864759-68-2)?

[3-Fluoro-4-(trifluoromethyl)phenyl]boronic acid is a solid with a crystalline form. Its molecular w...

Compound Q&A

What industries use [3-Fluoro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 864759-68-2)?

[3-Fluoro-4-(trifluoromethyl)phenyl]boronic acid is used in various industries, particularly in phar...

Compound Q&A

What precautions should be taken when handling [3-Fluoro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 864759-68-2)?

When handling [3-Fluoro-4-(trifluoromethyl)phenyl]boronic acid, it is essential to use appropriate p...

Compound Q&A

What is the market or research trend for N-Methylphenylalanine (CAS: 2566-30-5)?

The market for N-Methylphenylalanine (CAS: 2566-30-5) is growing due to its appl...

2566-30-5N-Methylphenylalanin...
Compound Q&A

What are the main uses of 4-[(1R)-1-Aminoethyl]benzonitrile (CAS: 210488-53-2)?

4-[(1R)-1-Aminoethyl]benzonitrile (CAS: 210488-53-2) is primarily used in pharma...

210488-53-24-[(1R)-1-Aminoethyl...
Compound Q&A

Is 2-Hydroxy-N-{3-[3-(1-piperidinylmethyl)phenoxy]propyl}acetamide ethanedioate (CAS: 110925-92-3) safe?

2-Hydroxy-N-{3-[3-(1-piperidinylmethyl)phenoxy]propyl}acetamide ethanedioate (CA...

110925-92-32-Hydroxy-N-{3-[3-(1...
Compound Q&A

What are the physical and chemical properties of 2-(5-Oxazolyl)benzoic Acid (CAS: 169508-94-5)?

2-(5-Oxazolyl)benzoic Acid (CAS: 169508-94-5) is a white crystalline solid with ...

169508-94-52-(5-Oxazolyl)benzoi...