Compound Q&A

What are the physical and chemical properties of Isolicoflavonol (CAS: 94805-83-1)?

Answer

Isolicoflavonol
Isolicoflavonol is a yellow crystalline solid with a molecular weight of approximately 268.23 g/mol. It has a melting point of around 230°C and is sparingly soluble in water but soluble in organic solvents such as ethanol and methanol. Isolicoflavonol exhibits stability under normal conditions but can react with acids and bases to form derivatives.

About

CAS No 94805-83-1
English Name Isolicoflavonol
Molecular Formula C20H18O6
Molecular Weight 354.36 g/mol
SMILES CC(=CCC1=C(C=CC(=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O)C
InChIKey PGCKDCPTJAQQSQ-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is Isolicoflavonol (CAS: 94805-83-1) typically synthesized?

Isolicoflavonol can be synthesized through a series of steps involving condensation reactions, such ...

Compound Q&A

What industries use Isolicoflavonol (CAS: 94805-83-1)?

Isolicoflavonol is used in the pharmaceutical industry for its potential health benefits, particular...

Compound Q&A

What precautions should be taken when handling Isolicoflavonol (CAS: 94805-83-1)?

Isolicoflavonol should be handled with appropriate personal protective equipment (PPE) such as glove...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...