Compound Q&A

What are the physical and chemical properties of Glycyl-L-glutamine monohydrate (CAS: 172669-64-6)?

Answer

Glycyl-L-glutamine monohydrate
Glycyl-L-glutamine monohydrate is a crystalline solid with a molecular weight of approximately 343.44 g/mol. It has a solubility of about 20 g/L in water at 20°C and is slightly acidic. The compound is relatively stable under normal conditions but can degrade over time in the presence of moisture and light. It reacts with strong bases to form salts and with strong acids to form esters.

About

English Name Glycyl-L-glutamine monohydrate
Molecular Formula C7H15N3O5
Molecular Weight 221.21 g/mol
SMILES C(CC(=O)N)C(C(=O)O)NC(=O)CN.O
InChIKey KLFWVRQACSYLOH-WCCKRBBISA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is Glycyl-L-glutamine monohydrate (CAS: 172669-64-6) typically synthesized?

Glycyl-L-glutamine monohydrate is typically synthesized by the condensation of glycine and L-glutami...

Compound Q&A

What industries use Glycyl-L-glutamine monohydrate (CAS: 172669-64-6)?

Glycyl-L-glutamine monohydrate is primarily used in the pharmaceutical industry as an intermediate i...

Compound Q&A

What precautions should be taken when handling Glycyl-L-glutamine monohydrate (CAS: 172669-64-6)?

When handling Glycyl-L-glutamine monohydrate, it is important to wear proper personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...