Compound Q&A

How is [4-(Benzyloxy)-3-fluorophenyl]boronic acid (CAS: 133057-83-7) typically synthesized?

Answer

[4-(Benzyloxy)-3-fluorophenyl]boronic acid
[4-(Benzyloxy)-3-fluorophenyl]boronic acid is usually synthesized by the reaction of 3-fluorobenzoic acid with phenyl boronic acid in the presence of a base such as sodium carbonate, using a suitable solvent like methanol or ethanol. The reaction typically occurs at elevated temperatures and yields up to 90% of the product, with good selectivity towards the boronic ester.

About

English Name [4-(Benzyloxy)-3-fluorophenyl]boronic acid
Molecular Formula C13H12BFO3
Molecular Weight 246.05 g/mol
SMILES B(C1=CC(=C(C=C1)OCC2=CC=CC=C2)F)(O)O
InChIKey DQPDLDQJMUGVGI-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of [4-(Benzyloxy)-3-fluorophenyl]boronic acid (CAS: 133057-83-7)?

[4-(Benzyloxy)-3-fluorophenyl]boronic acid is a white or off-white crystalline solid with a molecula...

Compound Q&A

What industries use [4-(Benzyloxy)-3-fluorophenyl]boronic acid (CAS: 133057-83-7)?

[4-(Benzyloxy)-3-fluorophenyl]boronic acid finds applications in the pharmaceutical industry as a pr...

Compound Q&A

What precautions should be taken when handling [4-(Benzyloxy)-3-fluorophenyl]boronic acid (CAS: 133057-83-7)?

When handling [4-(Benzyloxy)-3-fluorophenyl]boronic acid, it is important to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...