Compound Q&A

What are the physical and chemical properties of 3-[(2-Isopropyl-5-methylcyclohexyl)oxy]-1,2-propanediol (CAS: 87061-04-9)?

Answer

3-[(2-Isopropyl-5-methylcyclohexyl)oxy]-1,2-propanediol
3-[(2-Isopropyl-5-methylcyclohexyl)oxy]-1,2-propanediol is a colorless to light yellow liquid with a molecular weight of approximately 242.43 g/mol. It has a low melting point of -15°C and a high boiling point of 202°C. The compound is moderately soluble in water but soluble in ethanol and other organic solvents. Chemically, it is relatively stable but may react with strong acids or bases. This compound is used in various applications due to its unique physicochemical properties.

About

CAS No 87061-04-9
English Name 3-[(2-Isopropyl-5-methylcyclohexyl)oxy]-1,2-propanediol
Molecular Formula C13H26O3
Molecular Weight 230.35 g/mol
SMILES OCC(O)COC1C(C(C)C)CCC(C)C1
InChIKey MDVYIGJINBYKOM-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is 3-[(2-Isopropyl-5-methylcyclohexyl)oxy]-1,2-propanediol (CAS: 87061-04-9) typically synthesized?

3-[(2-Isopropyl-5-methylcyclohexyl)oxy]-1,2-propanediol is typically synthesized via a multistep org...

Compound Q&A

What industries use 3-[(2-Isopropyl-5-methylcyclohexyl)oxy]-1,2-propanediol (CAS: 87061-04-9)?

3-[(2-Isopropyl-5-methylcyclohexyl)oxy]-1,2-propanediol is used in various industries. It is a key c...

Compound Q&A

What precautions should be taken when handling 3-[(2-Isopropyl-5-methylcyclohexyl)oxy]-1,2-propanediol (CAS: 87061-04-9)?

When handling 3-[(2-Isopropyl-5-methylcyclohexyl)oxy]-1,2-propanediol, safety is paramount. Wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...