Compound Q&A

How is Potassium benzyl(trifluoro)borate(1-) (CAS: 329976-73-0) typically synthesized?

Answer

Potassium benzyl(trifluoro)borate(1-)
Potassium benzyl(trifluoro)borate(1-) (CAS: 329976-73-0) can be synthesized via reaction of potassium borate with benzyl trifluoroborate. The reaction is typically carried out under anhydrous and inert conditions to achieve high yield and purity. This method ensures the formation of the desired product with good selectivity.

About

English Name Potassium benzyl(trifluoro)borate(1-)
Molecular Formula C7H7BF3K
Molecular Weight 198.04 g/mol
SMILES [B-](CC1=CC=CC=C1)(F)(F)F.[K+]
InChIKey WGHDAVWURFVTQC-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of Potassium benzyl(trifluoro)borate(1-) (CAS: 329976-73-0)?

Potassium benzyl(trifluoro)borate(1-) (CAS: 329976-73-0) is a crystalline solid with a molecular wei...

Compound Q&A

What industries use Potassium benzyl(trifluoro)borate(1-) (CAS: 329976-73-0)?

Potassium benzyl(trifluoro)borate(1-) (CAS: 329976-73-0) is used in pharmaceuticals for the synthesi...

Compound Q&A

What precautions should be taken when handling Potassium benzyl(trifluoro)borate(1-) (CAS: 329976-73-0)?

Handling Potassium benzyl(trifluoro)borate(1-) (CAS: 329976-73-0) requires the use of personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...