Compound Q&A

What precautions should be taken when handling 2-(Diphenylphosphino)-6-methylpyridine (CAS: 132682-77-0)?

Answer

2-(Diphenylphosphino)-6-methylpyridine
When handling 2-(Diphenylphosphino)-6-methylpyridine, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves and safety goggles. The compound should be handled in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up carefully using appropriate absorbent materials, and proper disposal procedures should be followed. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal guidelines.

About

English Name 2-(Diphenylphosphino)-6-methylpyridine
Molecular Formula C18H16NP
Molecular Weight 277.31 g/mol
SMILES CC1=NC(=CC=C1)P(C2=CC=CC=C2)C3=CC=CC=C3
InChIKey XEXYRTTUCDBSPJ-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(Diphenylphosphino)-6-methylpyridine (CAS: 132682-77-0)?

2-(Diphenylphosphino)-6-methylpyridine is a crystalline compound with a molecular weight of approxim...

Compound Q&A

How is 2-(Diphenylphosphino)-6-methylpyridine (CAS: 132682-77-0) typically synthesized?

2-(Diphenylphosphino)-6-methylpyridine is commonly synthesized via a multi-step process involving th...

Compound Q&A

What industries use 2-(Diphenylphosphino)-6-methylpyridine (CAS: 132682-77-0)?

2-(Diphenylphosphino)-6-methylpyridine is used in various industries, particularly in pharmaceutical...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...