Compound Q&A

What industries use 4-Methoxy-N-(4-methoxyphenyl)-N-phenylaniline (CAS: 20440-94-2)?

Answer

4-Methoxy-N-(4-methoxyphenyl)-N-phenylaniline
4-Methoxy-N-(4-methoxyphenyl)-N-phenylaniline is used in various industries, including pharmaceuticals, where it serves as a precursor for drug synthesis. It is also utilized in the production of dyes and pigments, as well as in the manufacturing of resins and polymers. Additionally, it has applications in the development of sensors and semiconductors due to its electronic properties.

About

CAS No 20440-94-2
English Name 4-Methoxy-N-(4-methoxyphenyl)-N-phenylaniline
Molecular Formula C20H19NO2
Molecular Weight 305.38 g/mol
SMILES COc1ccc(cc1)N(c1ccc(cc1)OC)c1ccccc1
InChIKey ZJPTYHDCQPDNBH-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Methoxy-N-(4-methoxyphenyl)-N-phenylaniline (CAS: 20440-94-2)?

4-Methoxy-N-(4-methoxyphenyl)-N-phenylaniline is a crystalline solid with a molecular weight of appr...

Compound Q&A

How is 4-Methoxy-N-(4-methoxyphenyl)-N-phenylaniline (CAS: 20440-94-2) typically synthesized?

4-Methoxy-N-(4-methoxyphenyl)-N-phenylaniline is typically synthesized through a multistep process i...

Compound Q&A

What precautions should be taken when handling 4-Methoxy-N-(4-methoxyphenyl)-N-phenylaniline (CAS: 20440-94-2)?

When handling 4-Methoxy-N-(4-methoxyphenyl)-N-phenylaniline, it is important to use personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...