Compound Q&A

What precautions should be taken when handling Timosaponin B III (CAS: 142759-74-8)?

Answer

Timosaponin B III
When handling Timosaponin B III (CAS: 142759-74-8), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, laboratory coat, and safety goggles. Work should be conducted in a well-ventilated fume hood. In case of a spill, neutralize with a basic compound and clean with water. Always refer to the safety data sheet (SDS) for comprehensive safety guidelines and first aid procedures.

About

English Name Timosaponin B III
Molecular Formula C21H40O5
Molecular Weight 372.54 g/mol
SMILES CCCCCCC(CC=CCCCCCCCC(=O)OCC(CO)O)O
InChIKey HDIFHQMREAYYJW-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Timosaponin B III (CAS: 142759-74-8)?

Timosaponin B III (CAS: 142759-74-8) is a white crystalline powder. Its molecular weight is approxim...

Compound Q&A

How is Timosaponin B III (CAS: 142759-74-8) typically synthesized?

Timosaponin B III (CAS: 142759-74-8) is usually synthesized via a semi-synthetic route starting from...

Compound Q&A

What industries use Timosaponin B III (CAS: 142759-74-8)?

Timosaponin B III (CAS: 142759-74-8) is primarily used in the pharmaceutical industry, where it is i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...