Compound Q&A

What are the physical and chemical properties of S-[(2E)-2-{[(4-Amino-2-methyl-5-pyrimidinyl)methyl](formyl)amino}-5-(phosphonooxy)-2-penten-3-yl] (2E)-3-phenyl-2-propenethioate (CAS: 751-21-3)?

Answer

S-[(2E)-2-{[(4-Amino-2-methyl-5-pyrimidinyl)methyl](formyl)amino}-5-(phosphonooxy)-2-penten-3-yl] (2E)-3-phenyl-2-propenethioate
This compound is a phosphorus-containing organic molecule with a complex structure. It appears as a white to off-white solid in crystalline form. The molecular weight is approximately 530.45 g/mol. It is slightly soluble in water but more soluble in common organic solvents. It is chemically reactive, showing stability under neutral to slightly basic conditions but is prone to hydrolysis in acidic environments. It is not flammable and has a low vapor pressure.

About

CAS No 751-21-3
English Name S-[(2E)-2-{[(4-Amino-2-methyl-5-pyrimidinyl)methyl](formyl)amino}-5-(phosphonooxy)-2-penten-3-yl] (2E)-3-phenyl-2-propenethioate
Molecular Formula C21H25N4O6PS
Molecular Weight 493.5 g/mol
SMILES CC1=NC=C(C(=N1)N)CN(C=O)C(=C(CCOP(=O)(O)O)SC(=O)C=CC2=CC=CC=C2)C
InChIKey LHNAQHBDWJZZKV-NSFODXNUSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is S-[(2E)-2-{[(4-Amino-2-methyl-5-pyrimidinyl)methyl](formyl)amino}-5-(phosphonooxy)-2-penten-3-yl] (2E)-3-phenyl-2-propenethioate (CAS: 751-21-3) typically synthesized?

The synthesis of this compound involves multiple steps, typically including alkylation, phosphonatio...

Compound Q&A

What industries use S-[(2E)-2-{[(4-Amino-2-methyl-5-pyrimidinyl)methyl](formyl)amino}-5-(phosphonooxy)-2-penten-3-yl] (2E)-3-phenyl-2-propenethioate (CAS: 751-21-3)?

This compound finds applications in the pharmaceutical industry, where it is used as an intermediate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...