Compound Q&A

What precautions should be taken when handling N-(2-Naphthyl)-N',N'-bis{4-[2-naphthyl(phenyl)amino]phenyl}-N-phenyl-1,4-benzenediamine (CAS: 185690-41-9)?

Answer

N-(2-Naphthyl)-N',N'-bis{4-[2-naphthyl(phenyl)amino]phenyl}-N-phenyl-1,4-benzenediamine
Handling this compound requires appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be conducted in a fume hood to minimize exposure. Spills should be cleaned up using appropriate solvents, and the material safety data sheet (MSDS) should be consulted for detailed emergency procedures. Storage should be in a cool, dry place, away from incompatible materials and ignition sources.

About

English Name N-(2-Naphthyl)-N',N'-bis{4-[2-naphthyl(phenyl)amino]phenyl}-N-phenyl-1,4-benzenediamine
Molecular Formula C66H48N4
Molecular Weight 897.14 g/mol
SMILES C1=CC=C(C=C1)N(C2=CC=C(C=C2)N(C3=CC=C(C=C3)N(C4=CC=CC=C4)C5=CC6=CC=CC=C6C=C5)C7=CC=C(C=C7)N(C8=CC=CC=C8)C9=CC1=CC=CC=C1C=C9)C1=CC2=CC=CC=C2C=C1
InChIKey KDOQMLIRFUVJNT-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-(2-Naphthyl)-N',N'-bis{4-[2-naphthyl(phenyl)amino]phenyl}-N-phenyl-1,4-benzenediamine (CAS: 185690-41-9)?

N-(2-Naphthyl)-N',N'-bis{4-[2-naphthyl(phenyl)amino]phenyl}-N-phenyl-1,4-benzenediamine is a crystal...

Compound Q&A

How is N-(2-Naphthyl)-N',N'-bis{4-[2-naphthyl(phenyl)amino]phenyl}-N-phenyl-1,4-benzenediamine (CAS: 185690-41-9) typically synthesized?

This compound is synthesized through a multistep process involving aromatic amines and naphthols, ut...

Compound Q&A

What industries use N-(2-Naphthyl)-N',N'-bis{4-[2-naphthyl(phenyl)amino]phenyl}-N-phenyl-1,4-benzenediamine (CAS: 185690-41-9)?

This compound is primarily used in the pharmaceutical industry for its potential applications in dru...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...