Compound Q&A

How is Sodium 2-[4-(2-hydroxyethyl)-1-piperazinyl]ethanesulfonate (CAS: 103404-87-1) typically synthesized?

Answer

Sodium 2-[4-(2-hydroxyethyl)-1-piperazinyl]ethanesulfonate
Sodium 2-[4-(2-hydroxyethyl)-1-piperazinyl]ethanesulfonate is typically synthesized by reacting ethanesulfonic acid with 4-(2-hydroxyethyl)-1-piperazine in the presence of a base, such as sodium hydroxide. The reaction yields a high purity product with good selectivity. The process is carried out at room temperature, and the yield is usually around 85-90%.

About

English Name Sodium 2-[4-(2-hydroxyethyl)-1-piperazinyl]ethanesulfonate
Molecular Formula C8H17N2NaO4S
Molecular Weight 260.29 g/mol
SMILES C1CN(CCN1CCO)CCS(=O)(=O)[O-].[Na+]
InChIKey RDZTWEVXRGYCFV-UHFFFAOYSA-M
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sodium 2-[4-(2-hydroxyethyl)-1-piperazinyl]ethanesulfonate (CAS: 103404-87-1)?

Sodium 2-[4-(2-hydroxyethyl)-1-piperazinyl]ethanesulfonate (CAS: 103404-87-1) is a white or off-whit...

Compound Q&A

What industries use Sodium 2-[4-(2-hydroxyethyl)-1-piperazinyl]ethanesulfonate (CAS: 103404-87-1)?

Sodium 2-[4-(2-hydroxyethyl)-1-piperazinyl]ethanesulfonate (CAS: 103404-87-1) is used in various ind...

Compound Q&A

What precautions should be taken when handling Sodium 2-[4-(2-hydroxyethyl)-1-piperazinyl]ethanesulfonate (CAS: 103404-87-1)?

When handling Sodium 2-[4-(2-hydroxyethyl)-1-piperazinyl]ethanesulfonate (CAS: 103404-87-1), it is i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...