Compound Q&A

What industries use (3beta)-Cholest-5-en-3-yl [2-(dimethylamino)ethyl]carbamate hydrochloride (CAS: 166023-21-8)?

Answer

(3beta)-Cholest-5-en-3-yl [2-(dimethylamino)ethyl]carbamate hydrochloride (1:1)
(3beta)-Cholest-5-en-3-yl [2-(dimethylamino)ethyl]carbamate hydrochloride (CAS: 166023-21-8) is primarily used in the pharmaceutical industry for the synthesis of cholesterol-related drugs and in the chemical industry for various applications. It is also utilized in research for its unique chemical structure, which makes it suitable for developing new materials and sensors.

About

English Name (3beta)-Cholest-5-en-3-yl [2-(dimethylamino)ethyl]carbamate hydrochloride (1:1)
Molecular Formula C32H57ClN2O2
Molecular Weight 537.2730000000004 g/mol
SMILES CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)OC(=O)NCCN(C)C)C)C.Cl
InChIKey ISXSJGHXHUZXNF-LXZPIJOJSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3beta)-Cholest-5-en-3-yl [2-(dimethylamino)ethyl]carbamate hydrochloride (CAS: 166023-21-8)?

(3beta)-Cholest-5-en-3-yl [2-(dimethylamino)ethyl]carbamate hydrochloride (CAS: 166023-21-8) is a cr...

Compound Q&A

How is (3beta)-Cholest-5-en-3-yl [2-(dimethylamino)ethyl]carbamate hydrochloride (CAS: 166021-8) typically synthesized?

(3beta)-Cholest-5-en-3-yl [2-(dimethylamino)ethyl]carbamate hydrochloride (CAS: 166023-21-8) is typi...

Compound Q&A

What precautions should be taken when handling (3beta)-Cholest-5-en-3-yl [2-(dimethylamino)ethyl]carbamate hydrochloride (CAS: 166023-21-8)?

When handling (3beta)-Cholest-5-en-3-yl [2-(dimethylamino)ethyl]carbamate hydrochloride (CAS: 166023...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...