Compound Q&A

How is Zinc bis(trifluoromethylsulfonyl)imide (CAS: 168106-25-0) typically synthesized?

Answer

Zinc bis(trifluoromethylsulfonyl)imide
Zinc bis(trifluoromethylsulfonyl)imide is typically synthesized by treating zinc oxide with triflic anhydride in the presence of a Lewis acid catalyst such as aluminum chloride. The reaction is carried out in a polar aprotic solvent like tetrahydrofuran (THF). The product is isolated by filtration and recrystallization, providing a pure crystalline form with high yield and selectivity.

About

English Name Zinc bis(trifluoromethylsulfonyl)imide
Molecular Formula C4F12N2O8S4Zn
Molecular Weight 625.67 g/mol
SMILES FC(S1(=O)=[O][Zn+2]2([O]=S(=O)([N-]1)C(F)(F)F)[O]=S(=O)([N-]S(=[O]2)(=O)C(F)(F)F)C(F)(F)F)(F)F
InChIKey QEORIOGPVTWFMH-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of Zinc bis(trifluoromethylsulfonyl)imide (CAS: 168106-25-0)?

Zinc bis(trifluoromethylsulfonyl)imide (CAS: 168106-25-0) is a white to off-white crystalline solid ...

Compound Q&A

What industries use Zinc bis(trifluoromethylsulfonyl)imide (CAS: 168106-25-0)?

Zinc bis(trifluoromethylsulfonyl)imide (CAS: 168106-25-0) is used in various industries including ph...

Compound Q&A

What precautions should be taken when handling Zinc bis(trifluoromethylsulfonyl)imide (CAS: 168106-25-0)?

When handling Zinc bis(trifluoromethylsulfonyl)imide (CAS: 168106-25-0), it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...