Compound Q&A

What are the physical and chemical properties of (DHQ)2Pyr (CAS: 149820-65-5)?

Answer

(DHQ)2Pyr
(DHQ)2Pyr is a yellow crystalline solid with a molecular weight of approximately 328.4 g/mol. It is slightly soluble in common organic solvents like ethanol and acetone. Chemically, it is moderately reactive, particularly towards nucleophilic aromatic substitution reactions. Its solubility and reactivity make it useful in organic synthesis and catalysis.

About

English Name (DHQ)2Pyr
Molecular Formula C56H60N6O4
Molecular Weight 881.1 g/mol
SMILES CCC1CN2CCC1CC2C(C3=C4C=C(C=CC4=NC=C3)OC)OC5=C(C(=NC(=N5)C6=CC=CC=C6)OC(C7CC8CCN7CC8CC)C9=C1C=C(C=CC1=NC=C9)OC)C1=CC=CC=C1
InChIKey SWKRDCRSJPRVNF-CVCJRGCISA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is (DHQ)2Pyr (CAS: 149820-65-5) typically synthesized?

(DHQ)2Pyr can be synthesized by the condensation of 1,1'-biphenyl-2,2'-dicarboxaldehyde with 1,1'-bi...

Compound Q&A

What industries use (DHQ)2Pyr (CAS: 149820-65-5)?

(DHQ)2Pyr is used in various industries, including pharmaceuticals for chiral synthesis, organic syn...

Compound Q&A

What precautions should be taken when handling (DHQ)2Pyr (CAS: 149820-65-5)?

When handling (DHQ)2Pyr, wear appropriate personal protective equipment (PPE) such as gloves and gog...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...