Compound Q&A

What precautions should be taken when handling BippyPhos (CAS: 894086-00-1)?

Answer

BippyPhos
When handling BippyPhos, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated fume hood to minimize inhalation risk. Spills should be immediately contained and cleaned up with caution, following safety data sheet (SDS) guidelines. Always consult the SDS for detailed safety information.

About

English Name BippyPhos
Molecular Formula C32H35N4P
Molecular Weight 506.63 g/mol
SMILES CC(C)(C)P(C1=CC=NN1C2=C(N(N=C2C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5)C(C)(C)C
InChIKey PTXJGGGNGMPMBG-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of BippyPhos (CAS: 894086-00-1)?

BippyPhos (CAS: 894086-00-1) is a crystalline compound with a molecular weight of approximately 250....

Compound Q&A

How is BippyPhos (CAS: 894086-00-1) typically synthesized?

BippyPhos is synthesized via a multi-step process involving the protection of a biphenyl derivative,...

Compound Q&A

What industries use BippyPhos (CAS: 894086-00-1)?

BippyPhos is widely used in the pharmaceutical industry for the synthesis of complex molecules. It i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...