Compound Q&A

What are the physical and chemical properties of Flavanomarein (CAS: 577-38-8)?

Answer

Flavanomarein
Flavanomarein (CAS: 577-38-8) is a crystalline compound with a molecular weight of approximately 362.24 g/mol. It has a high solubility in polar solvents like methanol and ethanol, and is moderately soluble in water. Chemically, it is relatively stable under acidic and neutral conditions but can be sensitive to strong bases. Its reactivity is low, making it suitable for various applications without significant degradation.

About

CAS No 577-38-8
English Name Flavanomarein
Molecular Formula C21H22O11
Molecular Weight 450.4 g/mol
SMILES C1C(OC2=C(C1=O)C=CC(=C2O)OC3C(C(C(C(O3)CO)O)O)O)C4=CC(=C(C=C4)O)O
InChIKey DGGOLFCPSUVVHX-RTHJTPBESA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is Flavanomarein (CAS: 577-38-8) typically synthesized?

Flavanomarein (CAS: 577-38-8) is typically synthesized through a multi-step process involving reacti...

Compound Q&A

What industries use Flavanomarein (CAS: 577-38-8)?

Flavanomarein (CAS: 577-38-8) finds application in the pharmaceutical industry for its potential ant...

Compound Q&A

What precautions should be taken when handling Flavanomarein (CAS: 577-38-8)?

When handling Flavanomarein (CAS: 577-38-8), it is important to use appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...