Compound Q&A

What are the physical and chemical properties of 1-Butyl-3-methylimidazolium dibutyl phosphate (CAS: 663199-28-8)?

Answer

1-Butyl-3-methylimidazolium dibutyl phosphate
The physical properties of 1-Butyl-3-methylimidazolium dibutyl phosphate include a crystalline form at room temperature, a molecular weight of approximately 442.68 g/mol, and good solubility in organic solvents. Chemically, it is highly reactive and exhibits good thermal stability and conductivity.

About

English Name 1-Butyl-3-methylimidazolium dibutyl phosphate
Molecular Formula C16H33N2O4P
Molecular Weight 348.42 g/mol
SMILES CCCCN1C=C[N+](=C1)C.CCCCOP(=O)([O-])OCCCC
InChIKey NTXQJRGQUZXUMU-UHFFFAOYSA-M
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is 1-Butyl-3-methylimidazolium dibutyl phosphate (CAS: 663199-28-8) typically synthesized?

1-Butyl-3-methylimidazolium dibutyl phosphate is typically synthesized through the reaction of 1-but...

Compound Q&A

What industries use 1-Butyl-3-methylimidazolium dibutyl phosphate (CAS: 663199-28-8)?

1-Butyl-3-methylimidazolium dibutyl phosphate is primarily used in the pharmaceutical, polymer, and ...

Compound Q&A

What precautions should be taken when handling 1-Butyl-3-methylimidazolium dibutyl phosphate (CAS: 663199-28-8)?

When handling 1-Butyl-3-methylimidazolium dibutyl phosphate, it is essential to use personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...